About 7,8-dihydro-3H-pyrrolo[3,4-b]azepin-6-one;ethane
7,8-dihydro-3H-pyrrolo[3,4-b]azepin-6-one;ethane (PubChem CID 156794178) has the molecular formula C10H14N2O
and a molecular weight of 178.23 g/mol. Its IUPAC name is 7,8-dihydro-3H-pyrrolo[3,4-b]azepin-6-one;ethane.
Molecular Properties
| Compound Name | 7,8-dihydro-3H-pyrrolo[3,4-b]azepin-6-one;ethane |
| PubChem CID | 156794178 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 7,8-dihydro-3H-pyrrolo[3,4-b]azepin-6-one;ethane |
| SMILES | CC.O=C1NCC2=C1C=CCC=N2 |
| InChI | InChI=1S/C8H8N2O.C2H6/c11-8-6-3-1-2-4-9-7(6)5-10-8;1-2/h1,3-4H,2,5H2,(H,10,11);1-2H3 |
| InChIKey | GJNSPQFAWDPEKS-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7,8-dihydro-3H-pyrrolo[3,4-b]azepin-6-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dihydro-3H-pyrrolo[3,4-b]azepin-6-one;ethane?
The IUPAC name of 7,8-dihydro-3H-pyrrolo[3,4-b]azepin-6-one;ethane (CID 156794178) is 7,8-dihydro-3H-pyrrolo[3,4-b]azepin-6-one;ethane.
What is the SMILES notation for 7,8-dihydro-3H-pyrrolo[3,4-b]azepin-6-one;ethane?
The canonical SMILES for 7,8-dihydro-3H-pyrrolo[3,4-b]azepin-6-one;ethane is CC.O=C1NCC2=C1C=CCC=N2.
What is the InChIKey of 7,8-dihydro-3H-pyrrolo[3,4-b]azepin-6-one;ethane?
The InChIKey is GJNSPQFAWDPEKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O.C2H6/c11-8-6-3-1-2-4-9-7(6)5-10-8;1-2/h1,3-4H,2,5H2,(H,10,11);1-2H3.
What are the key properties of 7,8-dihydro-3H-pyrrolo[3,4-b]azepin-6-one;ethane?
7,8-dihydro-3H-pyrrolo[3,4-b]azepin-6-one;ethane has a molecular weight of 178.23 g/mol, XLogP of 1.43, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dihydro-3H-pyrrolo[3,4-b]azepin-6-one;ethane is sourced from PubChem (CID 156794178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).