C16H20N2O3 — CID 156794502
piperidine-2,6-dione;4-propan-2-yl-2,3-dihydroisoindol-1-one (PubChem CID 156794502) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is piperidine-2,6-dione;4-propan-2-yl-2,3-dihydroisoindol-1-one.
| Compound Name | piperidine-2,6-dione;4-propan-2-yl-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 156794502 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | piperidine-2,6-dione;4-propan-2-yl-2,3-dihydroisoindol-1-one |
| SMILES | CC(C)c1cccc2c1CNC2=O.O=C1CCCC(=O)N1 |
| InChI | InChI=1S/C11H13NO.C5H7NO2/c1-7(2)8-4-3-5-9-10(8)6-12-11(9)13;7-4-2-1-3-5(8)6-4/h3-5,7H,6H2,1-2H3,(H,12,13);1-3H2,(H,6,7,8) |
| InChIKey | OPJAETHISNCMOU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|