About N,3-dimethylbut-1-en-2-amine;4-(4-methylpent-2-ynyl)morpholine
N,3-dimethylbut-1-en-2-amine;4-(4-methylpent-2-ynyl)morpholine (PubChem CID 156795148) has the molecular formula C16H30N2O
and a molecular weight of 266.43 g/mol. Its IUPAC name is N,3-dimethylbut-1-en-2-amine;4-(4-methylpent-2-ynyl)morpholine.
Molecular Properties
| Compound Name | N,3-dimethylbut-1-en-2-amine;4-(4-methylpent-2-ynyl)morpholine |
| PubChem CID | 156795148 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | N,3-dimethylbut-1-en-2-amine;4-(4-methylpent-2-ynyl)morpholine |
| SMILES | C=C(NC)C(C)C.CC(C)C#CCN1CCOCC1 |
| InChI | InChI=1S/C10H17NO.C6H13N/c1-10(2)4-3-5-11-6-8-12-9-7-11;1-5(2)6(3)7-4/h10H,5-9H2,1-2H3;5,7H,3H2,1-2,4H3 |
| InChIKey | KOYYQFZHIQHISU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N,3-dimethylbut-1-en-2-amine;4-(4-methylpent-2-ynyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3-dimethylbut-1-en-2-amine;4-(4-methylpent-2-ynyl)morpholine?
The IUPAC name of N,3-dimethylbut-1-en-2-amine;4-(4-methylpent-2-ynyl)morpholine (CID 156795148) is N,3-dimethylbut-1-en-2-amine;4-(4-methylpent-2-ynyl)morpholine.
What is the SMILES notation for N,3-dimethylbut-1-en-2-amine;4-(4-methylpent-2-ynyl)morpholine?
The canonical SMILES for N,3-dimethylbut-1-en-2-amine;4-(4-methylpent-2-ynyl)morpholine is C=C(NC)C(C)C.CC(C)C#CCN1CCOCC1.
What is the InChIKey of N,3-dimethylbut-1-en-2-amine;4-(4-methylpent-2-ynyl)morpholine?
The InChIKey is KOYYQFZHIQHISU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO.C6H13N/c1-10(2)4-3-5-11-6-8-12-9-7-11;1-5(2)6(3)7-4/h10H,5-9H2,1-2H3;5,7H,3H2,1-2,4H3.
What are the key properties of N,3-dimethylbut-1-en-2-amine;4-(4-methylpent-2-ynyl)morpholine?
N,3-dimethylbut-1-en-2-amine;4-(4-methylpent-2-ynyl)morpholine has a molecular weight of 266.43 g/mol, XLogP of 2.35, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,3-dimethylbut-1-en-2-amine;4-(4-methylpent-2-ynyl)morpholine is sourced from PubChem (CID 156795148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).