C15H34F3NO2 — CID 156795196
methane;molecular hydrogen;1,1,1-trifluoro-N-[2-[2-(4-methylhexoxy)ethoxy]ethyl]propan-2-amine (PubChem CID 156795196) has the molecular formula C15H34F3NO2 and a molecular weight of 317.44 g/mol. Its IUPAC name is methane;molecular hydrogen;1,1,1-trifluoro-N-[2-[2-(4-methylhexoxy)ethoxy]ethyl]propan-2-amine.
| Compound Name | methane;molecular hydrogen;1,1,1-trifluoro-N-[2-[2-(4-methylhexoxy)ethoxy]ethyl]propan-2-amine |
|---|---|
| PubChem CID | 156795196 |
| Molecular Formula | C15H34F3NO2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | methane;molecular hydrogen;1,1,1-trifluoro-N-[2-[2-(4-methylhexoxy)ethoxy]ethyl]propan-2-amine |
| SMILES | C.CCC(C)CCCOCCOCCNC(C)C(F)(F)F.[H][H] |
| InChI | InChI=1S/C14H28F3NO2.CH4.H2/c1-4-12(2)6-5-8-19-10-11-20-9-7-18-13(3)14(15,16)17;;/h12-13,18H,4-11H2,1-3H3;1H4;1H |
| InChIKey | FDGDYJJOSDWZKH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|