About methane;molecular hydrogen;1,1,1-trifluoro-N-[2-[2-(4-methylhexoxy)ethoxy]ethyl]propan-2-amine
methane;molecular hydrogen;1,1,1-trifluoro-N-[2-[2-(4-methylhexoxy)ethoxy]ethyl]propan-2-amine (PubChem CID 156795196) has the molecular formula C15H34F3NO2
and a molecular weight of 317.44 g/mol. Its IUPAC name is methane;molecular hydrogen;1,1,1-trifluoro-N-[2-[2-(4-methylhexoxy)ethoxy]ethyl]propan-2-amine.
Molecular Properties
| Compound Name | methane;molecular hydrogen;1,1,1-trifluoro-N-[2-[2-(4-methylhexoxy)ethoxy]ethyl]propan-2-amine |
| PubChem CID | 156795196 |
| Molecular Formula | C15H34F3NO2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | methane;molecular hydrogen;1,1,1-trifluoro-N-[2-[2-(4-methylhexoxy)ethoxy]ethyl]propan-2-amine |
| SMILES | C.CCC(C)CCCOCCOCCNC(C)C(F)(F)F.[H][H] |
| InChI | InChI=1S/C14H28F3NO2.CH4.H2/c1-4-12(2)6-5-8-19-10-11-20-9-7-18-13(3)14(15,16)17;;/h12-13,18H,4-11H2,1-3H3;1H4;1H |
| InChIKey | FDGDYJJOSDWZKH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methane;molecular hydrogen;1,1,1-trifluoro-N-[2-[2-(4-methylhexoxy)ethoxy]ethyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;molecular hydrogen;1,1,1-trifluoro-N-[2-[2-(4-methylhexoxy)ethoxy]ethyl]propan-2-amine?
The IUPAC name of methane;molecular hydrogen;1,1,1-trifluoro-N-[2-[2-(4-methylhexoxy)ethoxy]ethyl]propan-2-amine (CID 156795196) is methane;molecular hydrogen;1,1,1-trifluoro-N-[2-[2-(4-methylhexoxy)ethoxy]ethyl]propan-2-amine.
What is the SMILES notation for methane;molecular hydrogen;1,1,1-trifluoro-N-[2-[2-(4-methylhexoxy)ethoxy]ethyl]propan-2-amine?
The canonical SMILES for methane;molecular hydrogen;1,1,1-trifluoro-N-[2-[2-(4-methylhexoxy)ethoxy]ethyl]propan-2-amine is C.CCC(C)CCCOCCOCCNC(C)C(F)(F)F.[H][H].
What is the InChIKey of methane;molecular hydrogen;1,1,1-trifluoro-N-[2-[2-(4-methylhexoxy)ethoxy]ethyl]propan-2-amine?
The InChIKey is FDGDYJJOSDWZKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28F3NO2.CH4.H2/c1-4-12(2)6-5-8-19-10-11-20-9-7-18-13(3)14(15,16)17;;/h12-13,18H,4-11H2,1-3H3;1H4;1H.
What are the key properties of methane;molecular hydrogen;1,1,1-trifluoro-N-[2-[2-(4-methylhexoxy)ethoxy]ethyl]propan-2-amine?
methane;molecular hydrogen;1,1,1-trifluoro-N-[2-[2-(4-methylhexoxy)ethoxy]ethyl]propan-2-amine has a molecular weight of 317.44 g/mol, XLogP of 4.27, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;molecular hydrogen;1,1,1-trifluoro-N-[2-[2-(4-methylhexoxy)ethoxy]ethyl]propan-2-amine is sourced from PubChem (CID 156795196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).