About N-[(4-butylmorpholin-2-yl)methyl]-N-methylacetamide;ethane;sulfane
N-[(4-butylmorpholin-2-yl)methyl]-N-methylacetamide;ethane;sulfane (PubChem CID 156795217) has the molecular formula C14H32N2O2S
and a molecular weight of 292.49 g/mol. Its IUPAC name is N-[(4-butylmorpholin-2-yl)methyl]-N-methylacetamide;ethane;sulfane.
Molecular Properties
| Compound Name | N-[(4-butylmorpholin-2-yl)methyl]-N-methylacetamide;ethane;sulfane |
| PubChem CID | 156795217 |
| Molecular Formula | C14H32N2O2S |
| Molecular Weight | 292.49 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | N-[(4-butylmorpholin-2-yl)methyl]-N-methylacetamide;ethane;sulfane |
| SMILES | CC.CCCCN1CCOC(CN(C)C(C)=O)C1.S |
| InChI | InChI=1S/C12H24N2O2.C2H6.H2S/c1-4-5-6-14-7-8-16-12(10-14)9-13(3)11(2)15;1-2;/h12H,4-10H2,1-3H3;1-2H3;1H2 |
| InChIKey | HINDFVYCSPWADE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.49 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(4-butylmorpholin-2-yl)methyl]-N-methylacetamide;ethane;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-butylmorpholin-2-yl)methyl]-N-methylacetamide;ethane;sulfane?
The IUPAC name of N-[(4-butylmorpholin-2-yl)methyl]-N-methylacetamide;ethane;sulfane (CID 156795217) is N-[(4-butylmorpholin-2-yl)methyl]-N-methylacetamide;ethane;sulfane.
What is the SMILES notation for N-[(4-butylmorpholin-2-yl)methyl]-N-methylacetamide;ethane;sulfane?
The canonical SMILES for N-[(4-butylmorpholin-2-yl)methyl]-N-methylacetamide;ethane;sulfane is CC.CCCCN1CCOC(CN(C)C(C)=O)C1.S.
What is the InChIKey of N-[(4-butylmorpholin-2-yl)methyl]-N-methylacetamide;ethane;sulfane?
The InChIKey is HINDFVYCSPWADE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2.C2H6.H2S/c1-4-5-6-14-7-8-16-12(10-14)9-13(3)11(2)15;1-2;/h12H,4-10H2,1-3H3;1-2H3;1H2.
What are the key properties of N-[(4-butylmorpholin-2-yl)methyl]-N-methylacetamide;ethane;sulfane?
N-[(4-butylmorpholin-2-yl)methyl]-N-methylacetamide;ethane;sulfane has a molecular weight of 292.49 g/mol, XLogP of 2.10, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-butylmorpholin-2-yl)methyl]-N-methylacetamide;ethane;sulfane is sourced from PubChem (CID 156795217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).