C24H34F3N4OS+ — CID 156795569
ethane;trimethyl-[2-[[4-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]-2-pyridinyl]oxy]ethyl]azanium (PubChem CID 156795569) has the molecular formula C24H34F3N4OS+ and a molecular weight of 483.62 g/mol. Its IUPAC name is ethane;trimethyl-[2-[[4-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]-2-pyridinyl]oxy]ethyl]azanium.
| Compound Name | ethane;trimethyl-[2-[[4-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]-2-pyridinyl]oxy]ethyl]azanium |
|---|---|
| PubChem CID | 156795569 |
| Molecular Formula | C24H34F3N4OS+ |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | ethane;trimethyl-[2-[[4-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]-2-pyridinyl]oxy]ethyl]azanium |
| SMILES | CC.CC.C[N+](C)(C)CCOc1cc(-c2csc(Nc3cccc(C(F)(F)F)c3)n2)ccn1 |
| InChI | InChI=1S/C20H22F3N4OS.2C2H6/c1-27(2,3)9-10-28-18-11-14(7-8-24-18)17-13-29-19(26-17)25-16-6-4-5-15(12-16)20(21,22)23;2*1-2/h4-8,11-13H,9-10H2,1-3H3,(H,25,26);2*1-2H3/q+1;; |
| InChIKey | AKIUSKGXHDRDNT-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|