About 4-but-1-en-2-yl-5-ethenyl-1,3-dioxole
4-but-1-en-2-yl-5-ethenyl-1,3-dioxole (PubChem CID 156796243) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is 4-but-1-en-2-yl-5-ethenyl-1,3-dioxole.
Molecular Properties
| Compound Name | 4-but-1-en-2-yl-5-ethenyl-1,3-dioxole |
| PubChem CID | 156796243 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 4-but-1-en-2-yl-5-ethenyl-1,3-dioxole |
| SMILES | C=CC1=C(C(=C)CC)OCO1 |
| InChI | InChI=1S/C9H12O2/c1-4-7(3)9-8(5-2)10-6-11-9/h5H,2-4,6H2,1H3 |
| InChIKey | UEPOEIFHFJDULK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-but-1-en-2-yl-5-ethenyl-1,3-dioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-but-1-en-2-yl-5-ethenyl-1,3-dioxole?
The IUPAC name of 4-but-1-en-2-yl-5-ethenyl-1,3-dioxole (CID 156796243) is 4-but-1-en-2-yl-5-ethenyl-1,3-dioxole.
What is the SMILES notation for 4-but-1-en-2-yl-5-ethenyl-1,3-dioxole?
The canonical SMILES for 4-but-1-en-2-yl-5-ethenyl-1,3-dioxole is C=CC1=C(C(=C)CC)OCO1.
What is the InChIKey of 4-but-1-en-2-yl-5-ethenyl-1,3-dioxole?
The InChIKey is UEPOEIFHFJDULK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2/c1-4-7(3)9-8(5-2)10-6-11-9/h5H,2-4,6H2,1H3.
What are the key properties of 4-but-1-en-2-yl-5-ethenyl-1,3-dioxole?
4-but-1-en-2-yl-5-ethenyl-1,3-dioxole has a molecular weight of 152.19 g/mol, XLogP of 2.35, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-1-en-2-yl-5-ethenyl-1,3-dioxole is sourced from PubChem (CID 156796243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).