About 1-(2-fluorophenyl)butan-1-one;2-propoxybutane
1-(2-fluorophenyl)butan-1-one;2-propoxybutane (PubChem CID 156796432) has the molecular formula C17H27FO2
and a molecular weight of 282.40 g/mol. Its IUPAC name is 1-(2-fluorophenyl)butan-1-one;2-propoxybutane.
Molecular Properties
| Compound Name | 1-(2-fluorophenyl)butan-1-one;2-propoxybutane |
| PubChem CID | 156796432 |
| Molecular Formula | C17H27FO2 |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | 1-(2-fluorophenyl)butan-1-one;2-propoxybutane |
| SMILES | CCCC(=O)c1ccccc1F.CCCOC(C)CC |
| InChI | InChI=1S/C10H11FO.C7H16O/c1-2-5-10(12)8-6-3-4-7-9(8)11;1-4-6-8-7(3)5-2/h3-4,6-7H,2,5H2,1H3;7H,4-6H2,1-3H3 |
| InChIKey | PPJWZTJCJGMKFB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-fluorophenyl)butan-1-one;2-propoxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-fluorophenyl)butan-1-one;2-propoxybutane?
The IUPAC name of 1-(2-fluorophenyl)butan-1-one;2-propoxybutane (CID 156796432) is 1-(2-fluorophenyl)butan-1-one;2-propoxybutane.
What is the SMILES notation for 1-(2-fluorophenyl)butan-1-one;2-propoxybutane?
The canonical SMILES for 1-(2-fluorophenyl)butan-1-one;2-propoxybutane is CCCC(=O)c1ccccc1F.CCCOC(C)CC.
What is the InChIKey of 1-(2-fluorophenyl)butan-1-one;2-propoxybutane?
The InChIKey is PPJWZTJCJGMKFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FO.C7H16O/c1-2-5-10(12)8-6-3-4-7-9(8)11;1-4-6-8-7(3)5-2/h3-4,6-7H,2,5H2,1H3;7H,4-6H2,1-3H3.
What are the key properties of 1-(2-fluorophenyl)butan-1-one;2-propoxybutane?
1-(2-fluorophenyl)butan-1-one;2-propoxybutane has a molecular weight of 282.40 g/mol, XLogP of 5.02, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-fluorophenyl)butan-1-one;2-propoxybutane is sourced from PubChem (CID 156796432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).