C16H25FN2 — CID 156796461
(3Z,5Z)-4-ethenyl-5-(4-fluoro-4-methylpiperidin-1-yl)octa-1,3,5-trien-3-amine (PubChem CID 156796461) has the molecular formula C16H25FN2 and a molecular weight of 264.39 g/mol. Its IUPAC name is (3Z,5Z)-4-ethenyl-5-(4-fluoro-4-methylpiperidin-1-yl)octa-1,3,5-trien-3-amine.
| Compound Name | (3Z,5Z)-4-ethenyl-5-(4-fluoro-4-methylpiperidin-1-yl)octa-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 156796461 |
| Molecular Formula | C16H25FN2 |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | (3Z,5Z)-4-ethenyl-5-(4-fluoro-4-methylpiperidin-1-yl)octa-1,3,5-trien-3-amine |
| SMILES | C=C/C(N)=C(C=C)/C(=C/CC)N1CCC(C)(F)CC1 |
| InChI | InChI=1S/C16H25FN2/c1-5-8-15(13(6-2)14(18)7-3)19-11-9-16(4,17)10-12-19/h6-8H,2-3,5,9-12,18H2,1,4H3/b14-13-,15-8- |
| InChIKey | TWNHJOARNZIFTQ-BAEHMUKLSA-N |
| XLogP | 3.69 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|