About 2,4-dimethyl-2,3-dihydro-1H-quinoxaline;ethane
2,4-dimethyl-2,3-dihydro-1H-quinoxaline;ethane (PubChem CID 156796613) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is 2,4-dimethyl-2,3-dihydro-1H-quinoxaline;ethane.
Molecular Properties
| Compound Name | 2,4-dimethyl-2,3-dihydro-1H-quinoxaline;ethane |
| PubChem CID | 156796613 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 2,4-dimethyl-2,3-dihydro-1H-quinoxaline;ethane |
| SMILES | CC.CC1CN(C)c2ccccc2N1 |
| InChI | InChI=1S/C10H14N2.C2H6/c1-8-7-12(2)10-6-4-3-5-9(10)11-8;1-2/h3-6,8,11H,7H2,1-2H3;1-2H3 |
| InChIKey | PCMPCCLRYQYYBF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-dimethyl-2,3-dihydro-1H-quinoxaline;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-2,3-dihydro-1H-quinoxaline;ethane?
The IUPAC name of 2,4-dimethyl-2,3-dihydro-1H-quinoxaline;ethane (CID 156796613) is 2,4-dimethyl-2,3-dihydro-1H-quinoxaline;ethane.
What is the SMILES notation for 2,4-dimethyl-2,3-dihydro-1H-quinoxaline;ethane?
The canonical SMILES for 2,4-dimethyl-2,3-dihydro-1H-quinoxaline;ethane is CC.CC1CN(C)c2ccccc2N1.
What is the InChIKey of 2,4-dimethyl-2,3-dihydro-1H-quinoxaline;ethane?
The InChIKey is PCMPCCLRYQYYBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2.C2H6/c1-8-7-12(2)10-6-4-3-5-9(10)11-8;1-2/h3-6,8,11H,7H2,1-2H3;1-2H3.
What are the key properties of 2,4-dimethyl-2,3-dihydro-1H-quinoxaline;ethane?
2,4-dimethyl-2,3-dihydro-1H-quinoxaline;ethane has a molecular weight of 192.31 g/mol, XLogP of 2.96, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-2,3-dihydro-1H-quinoxaline;ethane is sourced from PubChem (CID 156796613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).