About cyclohexane;N-methyl-1-phenylcyclopropan-1-amine
cyclohexane;N-methyl-1-phenylcyclopropan-1-amine (PubChem CID 156796665) has the molecular formula C16H25N
and a molecular weight of 231.38 g/mol. Its IUPAC name is cyclohexane;N-methyl-1-phenylcyclopropan-1-amine.
Molecular Properties
| Compound Name | cyclohexane;N-methyl-1-phenylcyclopropan-1-amine |
| PubChem CID | 156796665 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | cyclohexane;N-methyl-1-phenylcyclopropan-1-amine |
| SMILES | C1CCCCC1.CNC1(c2ccccc2)CC1 |
| InChI | InChI=1S/C10H13N.C6H12/c1-11-10(7-8-10)9-5-3-2-4-6-9;1-2-4-6-5-3-1/h2-6,11H,7-8H2,1H3;1-6H2 |
| InChIKey | NNHVSFCCNCQIDO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclohexane;N-methyl-1-phenylcyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane;N-methyl-1-phenylcyclopropan-1-amine?
The IUPAC name of cyclohexane;N-methyl-1-phenylcyclopropan-1-amine (CID 156796665) is cyclohexane;N-methyl-1-phenylcyclopropan-1-amine.
What is the SMILES notation for cyclohexane;N-methyl-1-phenylcyclopropan-1-amine?
The canonical SMILES for cyclohexane;N-methyl-1-phenylcyclopropan-1-amine is C1CCCCC1.CNC1(c2ccccc2)CC1.
What is the InChIKey of cyclohexane;N-methyl-1-phenylcyclopropan-1-amine?
The InChIKey is NNHVSFCCNCQIDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N.C6H12/c1-11-10(7-8-10)9-5-3-2-4-6-9;1-2-4-6-5-3-1/h2-6,11H,7-8H2,1H3;1-6H2.
What are the key properties of cyclohexane;N-methyl-1-phenylcyclopropan-1-amine?
cyclohexane;N-methyl-1-phenylcyclopropan-1-amine has a molecular weight of 231.38 g/mol, XLogP of 4.24, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane;N-methyl-1-phenylcyclopropan-1-amine is sourced from PubChem (CID 156796665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).