About (Z)-but-2-ene;(3Z)-4-[4-(difluoromethyl)piperidin-1-yl]hexa-1,3,5-trien-3-amine;ethane
(Z)-but-2-ene;(3Z)-4-[4-(difluoromethyl)piperidin-1-yl]hexa-1,3,5-trien-3-amine;ethane (PubChem CID 156796667) has the molecular formula C18H32F2N2
and a molecular weight of 314.46 g/mol. Its IUPAC name is (Z)-but-2-ene;(3Z)-4-[4-(difluoromethyl)piperidin-1-yl]hexa-1,3,5-trien-3-amine;ethane.
Molecular Properties
| Compound Name | (Z)-but-2-ene;(3Z)-4-[4-(difluoromethyl)piperidin-1-yl]hexa-1,3,5-trien-3-amine;ethane |
| PubChem CID | 156796667 |
| Molecular Formula | C18H32F2N2 |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | (Z)-but-2-ene;(3Z)-4-[4-(difluoromethyl)piperidin-1-yl]hexa-1,3,5-trien-3-amine;ethane |
| SMILES | C/C=C\C.C=C/C(N)=C(\C=C)N1CCC(C(F)F)CC1.CC |
| InChI | InChI=1S/C12H18F2N2.C4H8.C2H6/c1-3-10(15)11(4-2)16-7-5-9(6-8-16)12(13)14;1-3-4-2;1-2/h3-4,9,12H,1-2,5-8,15H2;3-4H,1-2H3;1-2H3/b11-10-;4-3-; |
| InChIKey | SNPIUYCAHXJWQT-NDENJAFCSA-N |
| XLogP | 5.11 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-ene;(3Z)-4-[4-(difluoromethyl)piperidin-1-yl]hexa-1,3,5-trien-3-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-ene;(3Z)-4-[4-(difluoromethyl)piperidin-1-yl]hexa-1,3,5-trien-3-amine;ethane?
The IUPAC name of (Z)-but-2-ene;(3Z)-4-[4-(difluoromethyl)piperidin-1-yl]hexa-1,3,5-trien-3-amine;ethane (CID 156796667) is (Z)-but-2-ene;(3Z)-4-[4-(difluoromethyl)piperidin-1-yl]hexa-1,3,5-trien-3-amine;ethane.
What is the SMILES notation for (Z)-but-2-ene;(3Z)-4-[4-(difluoromethyl)piperidin-1-yl]hexa-1,3,5-trien-3-amine;ethane?
The canonical SMILES for (Z)-but-2-ene;(3Z)-4-[4-(difluoromethyl)piperidin-1-yl]hexa-1,3,5-trien-3-amine;ethane is C/C=C\C.C=C/C(N)=C(\C=C)N1CCC(C(F)F)CC1.CC.
What is the InChIKey of (Z)-but-2-ene;(3Z)-4-[4-(difluoromethyl)piperidin-1-yl]hexa-1,3,5-trien-3-amine;ethane?
The InChIKey is SNPIUYCAHXJWQT-NDENJAFCSA-N. The full InChI is InChI=1S/C12H18F2N2.C4H8.C2H6/c1-3-10(15)11(4-2)16-7-5-9(6-8-16)12(13)14;1-3-4-2;1-2/h3-4,9,12H,1-2,5-8,15H2;3-4H,1-2H3;1-2H3/b11-10-;4-3-;.
What are the key properties of (Z)-but-2-ene;(3Z)-4-[4-(difluoromethyl)piperidin-1-yl]hexa-1,3,5-trien-3-amine;ethane?
(Z)-but-2-ene;(3Z)-4-[4-(difluoromethyl)piperidin-1-yl]hexa-1,3,5-trien-3-amine;ethane has a molecular weight of 314.46 g/mol, XLogP of 5.11, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-ene;(3Z)-4-[4-(difluoromethyl)piperidin-1-yl]hexa-1,3,5-trien-3-amine;ethane is sourced from PubChem (CID 156796667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).