C10H18FN — CID 156796843
(3S,5R)-4-ethenyl-4-fluoro-1,3,5-trimethylpiperidine (PubChem CID 156796843) has the molecular formula C10H18FN and a molecular weight of 171.26 g/mol. Its IUPAC name is (3S,5R)-4-ethenyl-4-fluoro-1,3,5-trimethylpiperidine.
| Compound Name | (3S,5R)-4-ethenyl-4-fluoro-1,3,5-trimethylpiperidine |
|---|---|
| PubChem CID | 156796843 |
| Molecular Formula | C10H18FN |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | (3S,5R)-4-ethenyl-4-fluoro-1,3,5-trimethylpiperidine |
| SMILES | C=CC1(F)[C@H](C)CN(C)C[C@@H]1C |
| InChI | InChI=1S/C10H18FN/c1-5-10(11)8(2)6-12(4)7-9(10)3/h5,8-9H,1,6-7H2,2-4H3/t8-,9+,10? |
| InChIKey | QXLVQNBFYMVPLS-ULKQDVFKSA-N |
| XLogP | 2.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|