C19H30FN3O — CID 156796864
2-[4-[1-(2,6-dimethylmorpholin-4-yl)ethyl]piperidin-1-yl]-3-fluoroaniline (PubChem CID 156796864) has the molecular formula C19H30FN3O and a molecular weight of 335.47 g/mol. Its IUPAC name is 2-[4-[1-(2,6-dimethylmorpholin-4-yl)ethyl]piperidin-1-yl]-3-fluoroaniline.
| Compound Name | 2-[4-[1-(2,6-dimethylmorpholin-4-yl)ethyl]piperidin-1-yl]-3-fluoroaniline |
|---|---|
| PubChem CID | 156796864 |
| Molecular Formula | C19H30FN3O |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.24 |
| IUPAC Name | 2-[4-[1-(2,6-dimethylmorpholin-4-yl)ethyl]piperidin-1-yl]-3-fluoroaniline |
| SMILES | CC1CN(C(C)C2CCN(c3c(N)cccc3F)CC2)CC(C)O1 |
| InChI | InChI=1S/C19H30FN3O/c1-13-11-23(12-14(2)24-13)15(3)16-7-9-22(10-8-16)19-17(20)5-4-6-18(19)21/h4-6,13-16H,7-12,21H2,1-3H3 |
| InChIKey | NXIIYXAYEAIWSX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|