C11H12N6O3 — CID 156797269
[(8-oxo-7H-pyrimido[5,4-d]pyrimidin-2-yl)amino] pyrrolidine-1-carboxylate (PubChem CID 156797269) has the molecular formula C11H12N6O3 and a molecular weight of 276.26 g/mol. Its IUPAC name is [(8-oxo-7H-pyrimido[5,4-d]pyrimidin-2-yl)amino] pyrrolidine-1-carboxylate.
| Compound Name | [(8-oxo-7H-pyrimido[5,4-d]pyrimidin-2-yl)amino] pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 156797269 |
| Molecular Formula | C11H12N6O3 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | [(8-oxo-7H-pyrimido[5,4-d]pyrimidin-2-yl)amino] pyrrolidine-1-carboxylate |
| SMILES | O=C(ONc1ncc2nc[nH]c(=O)c2n1)N1CCCC1 |
| InChI | InChI=1S/C11H12N6O3/c18-9-8-7(13-6-14-9)5-12-10(15-8)16-20-11(19)17-3-1-2-4-17/h5-6H,1-4H2,(H,12,15,16)(H,13,14,18) |
| InChIKey | DGGLVQNGNGIGAH-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|