C14H11Cl2FN6S — CID 156797282
4-N-(3,4-dichloro-2-fluorophenyl)-6-N-(methylsulfanylmethyl)pyrimido[5,4-d]pyrimidine-4,6-diamine (PubChem CID 156797282) has the molecular formula C14H11Cl2FN6S and a molecular weight of 385.26 g/mol. Its IUPAC name is 4-N-(3,4-dichloro-2-fluorophenyl)-6-N-(methylsulfanylmethyl)pyrimido[5,4-d]pyrimidine-4,6-diamine.
| Compound Name | 4-N-(3,4-dichloro-2-fluorophenyl)-6-N-(methylsulfanylmethyl)pyrimido[5,4-d]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 156797282 |
| Molecular Formula | C14H11Cl2FN6S |
| Molecular Weight | 385.26 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | 4-N-(3,4-dichloro-2-fluorophenyl)-6-N-(methylsulfanylmethyl)pyrimido[5,4-d]pyrimidine-4,6-diamine |
| SMILES | CSCNc1ncc2ncnc(Nc3ccc(Cl)c(Cl)c3F)c2n1 |
| InChI | InChI=1S/C14H11Cl2FN6S/c1-24-6-21-14-18-4-9-12(23-14)13(20-5-19-9)22-8-3-2-7(15)10(16)11(8)17/h2-5H,6H2,1H3,(H,18,21,23)(H,19,20,22) |
| InChIKey | PQTYZWPIDDNRFB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.26 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|