C26H27F3N4O2S — CID 156797571
N-[(2S)-2-[[7-butyl-8-(2,4-difluorophenyl)-2-oxo-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-4-yl]amino]propyl]-2-fluoroprop-2-enamide (PubChem CID 156797571) has the molecular formula C26H27F3N4O2S and a molecular weight of 516.59 g/mol. Its IUPAC name is N-[(2S)-2-[[7-butyl-8-(2,4-difluorophenyl)-2-oxo-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-4-yl]amino]propyl]-2-fluoroprop-2-enamide.
| Compound Name | N-[(2S)-2-[[7-butyl-8-(2,4-difluorophenyl)-2-oxo-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-4-yl]amino]propyl]-2-fluoroprop-2-enamide |
|---|---|
| PubChem CID | 156797571 |
| Molecular Formula | C26H27F3N4O2S |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | N-[(2S)-2-[[7-butyl-8-(2,4-difluorophenyl)-2-oxo-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-4-yl]amino]propyl]-2-fluoroprop-2-enamide |
| SMILES | C=C(F)C(=O)NC[C@H](C)Nc1nc(=O)n2c3c(c(-c4ccc(F)cc4F)c(CCCC)cc13)SCC2 |
| InChI | InChI=1S/C26H27F3N4O2S/c1-4-5-6-16-11-19-22-23(21(16)18-8-7-17(28)12-20(18)29)36-10-9-33(22)26(35)32-24(19)31-14(2)13-30-25(34)15(3)27/h7-8,11-12,14H,3-6,9-10,13H2,1-2H3,(H,30,34)(H,31,32,35)/t14-/m0/s1 |
| InChIKey | DJUUTNXZGOFTMJ-AWEZNQCLSA-N |
| XLogP | 5.19 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|