C30H40F2N2 — CID 156797784
N-[(3E,5E,7E,9E)-10-[3-(ethenylamino)-2,6,6-trimethylcyclohexen-1-yl]-4,8-dimethyldeca-1,3,5,7,9-pentaen-2-yl]-2,6-difluoro-5-methylcyclohexa-1,5-dien-1-amine (PubChem CID 156797784) has the molecular formula C30H40F2N2 and a molecular weight of 466.66 g/mol. Its IUPAC name is N-[(3E,5E,7E,9E)-10-[3-(ethenylamino)-2,6,6-trimethylcyclohexen-1-yl]-4,8-dimethyldeca-1,3,5,7,9-pentaen-2-yl]-2,6-difluoro-5-methylcyclohexa-1,5-dien-1-amine.
| Compound Name | N-[(3E,5E,7E,9E)-10-[3-(ethenylamino)-2,6,6-trimethylcyclohexen-1-yl]-4,8-dimethyldeca-1,3,5,7,9-pentaen-2-yl]-2,6-difluoro-5-methylcyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 156797784 |
| Molecular Formula | C30H40F2N2 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.32 |
| IUPAC Name | N-[(3E,5E,7E,9E)-10-[3-(ethenylamino)-2,6,6-trimethylcyclohexen-1-yl]-4,8-dimethyldeca-1,3,5,7,9-pentaen-2-yl]-2,6-difluoro-5-methylcyclohexa-1,5-dien-1-amine |
| SMILES | C=CNC1CCC(C)(C)C(/C=C/C(C)=C/C=C/C(C)=C/C(=C)NC2=C(F)CCC(C)=C2F)=C1C |
| InChI | InChI=1S/C30H40F2N2/c1-9-33-27-17-18-30(7,8)25(24(27)6)15-13-20(2)11-10-12-21(3)19-23(5)34-29-26(31)16-14-22(4)28(29)32/h9-13,15,19,27,33-34H,1,5,14,16-18H2,2-4,6-8H3/b12-10+,15-13+,20-11+,21-19+ |
| InChIKey | PAITZSKGEWAXKV-BBBVQPRYSA-N |
| XLogP | 8.55 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|