About ethane;N'-propylethanimidamide
ethane;N'-propylethanimidamide (PubChem CID 156797871) has the molecular formula C9H24N2
and a molecular weight of 160.30 g/mol. Its IUPAC name is ethane;N'-propylethanimidamide.
Molecular Properties
| Compound Name | ethane;N'-propylethanimidamide |
| PubChem CID | 156797871 |
| Molecular Formula | C9H24N2 |
| Molecular Weight | 160.30 g/mol |
| Exact Mass | 160.19 |
| IUPAC Name | ethane;N'-propylethanimidamide |
| SMILES | CC.CC.CCC/N=C(\C)N |
| InChI | InChI=1S/C5H12N2.2C2H6/c1-3-4-7-5(2)6;2*1-2/h3-4H2,1-2H3,(H2,6,7);2*1-2H3 |
| InChIKey | MLABVKOORVPHOV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;N'-propylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N'-propylethanimidamide?
The IUPAC name of ethane;N'-propylethanimidamide (CID 156797871) is ethane;N'-propylethanimidamide.
What is the SMILES notation for ethane;N'-propylethanimidamide?
The canonical SMILES for ethane;N'-propylethanimidamide is CC.CC.CCC/N=C(\C)N.
What is the InChIKey of ethane;N'-propylethanimidamide?
The InChIKey is MLABVKOORVPHOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2.2C2H6/c1-3-4-7-5(2)6;2*1-2/h3-4H2,1-2H3,(H2,6,7);2*1-2H3.
What are the key properties of ethane;N'-propylethanimidamide?
ethane;N'-propylethanimidamide has a molecular weight of 160.30 g/mol, XLogP of 2.83, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N'-propylethanimidamide is sourced from PubChem (CID 156797871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).