C19H24FNO2 — CID 156797952
(Z,5Z)-5-[1-[(3-fluoro-5-methylcyclohepta-2,4,6-trien-1-yl)amino]ethylidene]-3-methyloct-3-ene-2,6-dione (PubChem CID 156797952) has the molecular formula C19H24FNO2 and a molecular weight of 317.40 g/mol. Its IUPAC name is (Z,5Z)-5-[1-[(3-fluoro-5-methylcyclohepta-2,4,6-trien-1-yl)amino]ethylidene]-3-methyloct-3-ene-2,6-dione.
| Compound Name | (Z,5Z)-5-[1-[(3-fluoro-5-methylcyclohepta-2,4,6-trien-1-yl)amino]ethylidene]-3-methyloct-3-ene-2,6-dione |
|---|---|
| PubChem CID | 156797952 |
| Molecular Formula | C19H24FNO2 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | (Z,5Z)-5-[1-[(3-fluoro-5-methylcyclohepta-2,4,6-trien-1-yl)amino]ethylidene]-3-methyloct-3-ene-2,6-dione |
| SMILES | CCC(=O)C(/C=C(/C)C(C)=O)=C(/C)NC1C=CC(C)=CC(F)=C1 |
| InChI | InChI=1S/C19H24FNO2/c1-6-19(23)18(10-13(3)15(5)22)14(4)21-17-8-7-12(2)9-16(20)11-17/h7-11,17,21H,6H2,1-5H3/b13-10-,18-14- |
| InChIKey | OVEKWTVUEUONQW-MARCMYERSA-N |
| XLogP | 4.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|