C39H64N2O — CID 156798295
acetylene;(8E)-7-[4-(3,3-dimethylhexyl)-2-methyl-4-(methylaminomethyl)cyclohexyl]-4,4,7,8a-tetramethyl-3-methylidene-8-(2-oxoethylidene)-5,6-dihydro-4aH-naphthalene-2-carbonitrile;ethane (PubChem CID 156798295) has the molecular formula C39H64N2O and a molecular weight of 576.95 g/mol. Its IUPAC name is acetylene;(8E)-7-[4-(3,3-dimethylhexyl)-2-methyl-4-(methylaminomethyl)cyclohexyl]-4,4,7,8a-tetramethyl-3-methylidene-8-(2-oxoethylidene)-5,6-dihydro-4aH-naphthalene-2-carbonitrile;ethane.
| Compound Name | acetylene;(8E)-7-[4-(3,3-dimethylhexyl)-2-methyl-4-(methylaminomethyl)cyclohexyl]-4,4,7,8a-tetramethyl-3-methylidene-8-(2-oxoethylidene)-5,6-dihydro-4aH-naphthalene-2-carbonitrile;ethane |
|---|---|
| PubChem CID | 156798295 |
| Molecular Formula | C39H64N2O |
| Molecular Weight | 576.95 g/mol |
| Exact Mass | 576.50 |
| IUPAC Name | acetylene;(8E)-7-[4-(3,3-dimethylhexyl)-2-methyl-4-(methylaminomethyl)cyclohexyl]-4,4,7,8a-tetramethyl-3-methylidene-8-(2-oxoethylidene)-5,6-dihydro-4aH-naphthalene-2-carbonitrile;ethane |
| SMILES | C#C.C=C1C(C#N)=CC2(C)/C(=C/C=O)C(C)(C3CCC(CCC(C)(C)CCC)(CNC)CC3C)CCC2C1(C)C.CC |
| InChI | InChI=1S/C35H56N2O.C2H6.C2H2/c1-11-15-31(4,5)18-19-35(24-37-10)17-12-28(25(2)21-35)33(8)16-13-29-32(6,7)26(3)27(23-36)22-34(29,9)30(33)14-20-38;2*1-2/h14,20,22,25,28-29,37H,3,11-13,15-19,21,24H2,1-2,4-10H3;1-2H3;1-2H/b30-14+;; |
| InChIKey | ASTOHRWPLSJUDH-NDQUOMESSA-N |
| XLogP | 10.10 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.95 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|