About 2-(4-ethyl-3,3-difluoropiperidin-1-yl)-1-(3-methoxyazetidin-1-yl)ethanone;methane
2-(4-ethyl-3,3-difluoropiperidin-1-yl)-1-(3-methoxyazetidin-1-yl)ethanone;methane (PubChem CID 156799167) has the molecular formula C14H26F2N2O2
and a molecular weight of 292.37 g/mol. Its IUPAC name is 2-(4-ethyl-3,3-difluoropiperidin-1-yl)-1-(3-methoxyazetidin-1-yl)ethanone;methane.
Molecular Properties
| Compound Name | 2-(4-ethyl-3,3-difluoropiperidin-1-yl)-1-(3-methoxyazetidin-1-yl)ethanone;methane |
| PubChem CID | 156799167 |
| Molecular Formula | C14H26F2N2O2 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 2-(4-ethyl-3,3-difluoropiperidin-1-yl)-1-(3-methoxyazetidin-1-yl)ethanone;methane |
| SMILES | C.CCC1CCN(CC(=O)N2CC(OC)C2)CC1(F)F |
| InChI | InChI=1S/C13H22F2N2O2.CH4/c1-3-10-4-5-16(9-13(10,14)15)8-12(18)17-6-11(7-17)19-2;/h10-11H,3-9H2,1-2H3;1H4 |
| InChIKey | RISLHHLXULYYQP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-ethyl-3,3-difluoropiperidin-1-yl)-1-(3-methoxyazetidin-1-yl)ethanone;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethyl-3,3-difluoropiperidin-1-yl)-1-(3-methoxyazetidin-1-yl)ethanone;methane?
The IUPAC name of 2-(4-ethyl-3,3-difluoropiperidin-1-yl)-1-(3-methoxyazetidin-1-yl)ethanone;methane (CID 156799167) is 2-(4-ethyl-3,3-difluoropiperidin-1-yl)-1-(3-methoxyazetidin-1-yl)ethanone;methane.
What is the SMILES notation for 2-(4-ethyl-3,3-difluoropiperidin-1-yl)-1-(3-methoxyazetidin-1-yl)ethanone;methane?
The canonical SMILES for 2-(4-ethyl-3,3-difluoropiperidin-1-yl)-1-(3-methoxyazetidin-1-yl)ethanone;methane is C.CCC1CCN(CC(=O)N2CC(OC)C2)CC1(F)F.
What is the InChIKey of 2-(4-ethyl-3,3-difluoropiperidin-1-yl)-1-(3-methoxyazetidin-1-yl)ethanone;methane?
The InChIKey is RISLHHLXULYYQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22F2N2O2.CH4/c1-3-10-4-5-16(9-13(10,14)15)8-12(18)17-6-11(7-17)19-2;/h10-11H,3-9H2,1-2H3;1H4.
What are the key properties of 2-(4-ethyl-3,3-difluoropiperidin-1-yl)-1-(3-methoxyazetidin-1-yl)ethanone;methane?
2-(4-ethyl-3,3-difluoropiperidin-1-yl)-1-(3-methoxyazetidin-1-yl)ethanone;methane has a molecular weight of 292.37 g/mol, XLogP of 1.85, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethyl-3,3-difluoropiperidin-1-yl)-1-(3-methoxyazetidin-1-yl)ethanone;methane is sourced from PubChem (CID 156799167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).