C19H19F3N2S2 — CID 15679923
5-ethyl-N-(3-methylsulfanylphenyl)-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-2-imine (PubChem CID 15679923) has the molecular formula C19H19F3N2S2 and a molecular weight of 396.50 g/mol. Its IUPAC name is 5-ethyl-N-(3-methylsulfanylphenyl)-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-2-imine.
| Compound Name | 5-ethyl-N-(3-methylsulfanylphenyl)-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 15679923 |
| Molecular Formula | C19H19F3N2S2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 5-ethyl-N-(3-methylsulfanylphenyl)-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-2-imine |
| SMILES | CCC1CN(c2cccc(C(F)(F)F)c2)/C(=N/c2cccc(SC)c2)S1 |
| InChI | InChI=1S/C19H19F3N2S2/c1-3-16-12-24(15-8-4-6-13(10-15)19(20,21)22)18(26-16)23-14-7-5-9-17(11-14)25-2/h4-11,16H,3,12H2,1-2H3/b23-18- |
| InChIKey | HAGBGIMJIQEXCL-NKFKGCMQSA-N |
| XLogP | 6.45 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|