About potassium;1-[2-(3,3-difluoro-4-methylpiperidin-1-yl)acetyl]azetidin-3-olate;ethane
potassium;1-[2-(3,3-difluoro-4-methylpiperidin-1-yl)acetyl]azetidin-3-olate;ethane (PubChem CID 156799311) has the molecular formula C13H23F2KN2O2
and a molecular weight of 316.43 g/mol. Its IUPAC name is potassium;1-[2-(3,3-difluoro-4-methylpiperidin-1-yl)acetyl]azetidin-3-olate;ethane.
Molecular Properties
| Compound Name | potassium;1-[2-(3,3-difluoro-4-methylpiperidin-1-yl)acetyl]azetidin-3-olate;ethane |
| PubChem CID | 156799311 |
| Molecular Formula | C13H23F2KN2O2 |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | potassium;1-[2-(3,3-difluoro-4-methylpiperidin-1-yl)acetyl]azetidin-3-olate;ethane |
| SMILES | CC.CC1CCN(CC(=O)N2CC([O-])C2)CC1(F)F.[K+] |
| InChI | InChI=1S/C11H17F2N2O2.C2H6.K/c1-8-2-3-14(7-11(8,12)13)6-10(17)15-4-9(16)5-15;1-2;/h8-9H,2-7H2,1H3;1-2H3;/q-1;;+1 |
| InChIKey | MQPVMDPZQIZINK-UHFFFAOYSA-N |
| XLogP | -2.44 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze potassium;1-[2-(3,3-difluoro-4-methylpiperidin-1-yl)acetyl]azetidin-3-olate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;1-[2-(3,3-difluoro-4-methylpiperidin-1-yl)acetyl]azetidin-3-olate;ethane?
The IUPAC name of potassium;1-[2-(3,3-difluoro-4-methylpiperidin-1-yl)acetyl]azetidin-3-olate;ethane (CID 156799311) is potassium;1-[2-(3,3-difluoro-4-methylpiperidin-1-yl)acetyl]azetidin-3-olate;ethane.
What is the SMILES notation for potassium;1-[2-(3,3-difluoro-4-methylpiperidin-1-yl)acetyl]azetidin-3-olate;ethane?
The canonical SMILES for potassium;1-[2-(3,3-difluoro-4-methylpiperidin-1-yl)acetyl]azetidin-3-olate;ethane is CC.CC1CCN(CC(=O)N2CC([O-])C2)CC1(F)F.[K+].
What is the InChIKey of potassium;1-[2-(3,3-difluoro-4-methylpiperidin-1-yl)acetyl]azetidin-3-olate;ethane?
The InChIKey is MQPVMDPZQIZINK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F2N2O2.C2H6.K/c1-8-2-3-14(7-11(8,12)13)6-10(17)15-4-9(16)5-15;1-2;/h8-9H,2-7H2,1H3;1-2H3;/q-1;;+1.
What are the key properties of potassium;1-[2-(3,3-difluoro-4-methylpiperidin-1-yl)acetyl]azetidin-3-olate;ethane?
potassium;1-[2-(3,3-difluoro-4-methylpiperidin-1-yl)acetyl]azetidin-3-olate;ethane has a molecular weight of 316.43 g/mol, XLogP of -2.44, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;1-[2-(3,3-difluoro-4-methylpiperidin-1-yl)acetyl]azetidin-3-olate;ethane is sourced from PubChem (CID 156799311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).