About 6-cyclopropyl-1,4-dimethyl-2,3-dihydro-1H-cyclopenta[b]naphthalene;ethane;dihydrate
6-cyclopropyl-1,4-dimethyl-2,3-dihydro-1H-cyclopenta[b]naphthalene;ethane;dihydrate (PubChem CID 156799701) has the molecular formula C20H30O2
and a molecular weight of 302.46 g/mol. Its IUPAC name is 6-cyclopropyl-1,4-dimethyl-2,3-dihydro-1H-cyclopenta[b]naphthalene;ethane;dihydrate.
Molecular Properties
| Compound Name | 6-cyclopropyl-1,4-dimethyl-2,3-dihydro-1H-cyclopenta[b]naphthalene;ethane;dihydrate |
| PubChem CID | 156799701 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 6-cyclopropyl-1,4-dimethyl-2,3-dihydro-1H-cyclopenta[b]naphthalene;ethane;dihydrate |
| SMILES | CC.Cc1c2c(cc3ccc(C4CC4)cc13)C(C)CC2.O.O |
| InChI | InChI=1S/C18H20.C2H6.2H2O/c1-11-3-8-16-12(2)18-9-14(13-4-5-13)6-7-15(18)10-17(11)16;1-2;;/h6-7,9-11,13H,3-5,8H2,1-2H3;1-2H3;2*1H2 |
| InChIKey | MHEMWKBGACBKLA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 63.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 6-cyclopropyl-1,4-dimethyl-2,3-dihydro-1H-cyclopenta[b]naphthalene;ethane;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclopropyl-1,4-dimethyl-2,3-dihydro-1H-cyclopenta[b]naphthalene;ethane;dihydrate?
The IUPAC name of 6-cyclopropyl-1,4-dimethyl-2,3-dihydro-1H-cyclopenta[b]naphthalene;ethane;dihydrate (CID 156799701) is 6-cyclopropyl-1,4-dimethyl-2,3-dihydro-1H-cyclopenta[b]naphthalene;ethane;dihydrate.
What is the SMILES notation for 6-cyclopropyl-1,4-dimethyl-2,3-dihydro-1H-cyclopenta[b]naphthalene;ethane;dihydrate?
The canonical SMILES for 6-cyclopropyl-1,4-dimethyl-2,3-dihydro-1H-cyclopenta[b]naphthalene;ethane;dihydrate is CC.Cc1c2c(cc3ccc(C4CC4)cc13)C(C)CC2.O.O.
What is the InChIKey of 6-cyclopropyl-1,4-dimethyl-2,3-dihydro-1H-cyclopenta[b]naphthalene;ethane;dihydrate?
The InChIKey is MHEMWKBGACBKLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20.C2H6.2H2O/c1-11-3-8-16-12(2)18-9-14(13-4-5-13)6-7-15(18)10-17(11)16;1-2;;/h6-7,9-11,13H,3-5,8H2,1-2H3;1-2H3;2*1H2.
What are the key properties of 6-cyclopropyl-1,4-dimethyl-2,3-dihydro-1H-cyclopenta[b]naphthalene;ethane;dihydrate?
6-cyclopropyl-1,4-dimethyl-2,3-dihydro-1H-cyclopenta[b]naphthalene;ethane;dihydrate has a molecular weight of 302.46 g/mol, XLogP of 4.45, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclopropyl-1,4-dimethyl-2,3-dihydro-1H-cyclopenta[b]naphthalene;ethane;dihydrate is sourced from PubChem (CID 156799701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).