About 10,10,10-trifluoro-N'-hydroxydecanimidamide
10,10,10-trifluoro-N'-hydroxydecanimidamide (PubChem CID 156799942) has the molecular formula C10H19F3N2O
and a molecular weight of 240.27 g/mol. Its IUPAC name is 10,10,10-trifluoro-N'-hydroxydecanimidamide.
Molecular Properties
| Compound Name | 10,10,10-trifluoro-N'-hydroxydecanimidamide |
| PubChem CID | 156799942 |
| Molecular Formula | C10H19F3N2O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 10,10,10-trifluoro-N'-hydroxydecanimidamide |
| SMILES | N/C(CCCCCCCCC(F)(F)F)=N\O |
| InChI | InChI=1S/C10H19F3N2O/c11-10(12,13)8-6-4-2-1-3-5-7-9(14)15-16/h16H,1-8H2,(H2,14,15) |
| InChIKey | YWSBLLSLRDWNCA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 10,10,10-trifluoro-N'-hydroxydecanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10,10,10-trifluoro-N'-hydroxydecanimidamide?
The IUPAC name of 10,10,10-trifluoro-N'-hydroxydecanimidamide (CID 156799942) is 10,10,10-trifluoro-N'-hydroxydecanimidamide.
What is the SMILES notation for 10,10,10-trifluoro-N'-hydroxydecanimidamide?
The canonical SMILES for 10,10,10-trifluoro-N'-hydroxydecanimidamide is N/C(CCCCCCCCC(F)(F)F)=N\O.
What is the InChIKey of 10,10,10-trifluoro-N'-hydroxydecanimidamide?
The InChIKey is YWSBLLSLRDWNCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F3N2O/c11-10(12,13)8-6-4-2-1-3-5-7-9(14)15-16/h16H,1-8H2,(H2,14,15).
What are the key properties of 10,10,10-trifluoro-N'-hydroxydecanimidamide?
10,10,10-trifluoro-N'-hydroxydecanimidamide has a molecular weight of 240.27 g/mol, XLogP of 3.42, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10,10,10-trifluoro-N'-hydroxydecanimidamide is sourced from PubChem (CID 156799942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).