C12H19F3N2O — CID 156800088
5-ethyl-3-(8,8,8-trifluorooctyl)-1,2,4-oxadiazole (PubChem CID 156800088) has the molecular formula C12H19F3N2O and a molecular weight of 264.29 g/mol. Its IUPAC name is 5-ethyl-3-(8,8,8-trifluorooctyl)-1,2,4-oxadiazole.
| Compound Name | 5-ethyl-3-(8,8,8-trifluorooctyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 156800088 |
| Molecular Formula | C12H19F3N2O |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 5-ethyl-3-(8,8,8-trifluorooctyl)-1,2,4-oxadiazole |
| SMILES | CCc1nc(CCCCCCCC(F)(F)F)no1 |
| InChI | InChI=1S/C12H19F3N2O/c1-2-11-16-10(17-18-11)8-6-4-3-5-7-9-12(13,14)15/h2-9H2,1H3 |
| InChIKey | ZIBSVXBZIIBVJN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|