C26H32ClN2O6P — CID 156800113
tert-butyl 3-[3-[[4-(4-chlorophenyl)phenyl]methyl]-1,2,4-oxadiazol-5-yl]-2-diethoxyphosphorylpropanoate (PubChem CID 156800113) has the molecular formula C26H32ClN2O6P and a molecular weight of 534.98 g/mol. Its IUPAC name is tert-butyl 3-[3-[[4-(4-chlorophenyl)phenyl]methyl]-1,2,4-oxadiazol-5-yl]-2-diethoxyphosphorylpropanoate.
| Compound Name | tert-butyl 3-[3-[[4-(4-chlorophenyl)phenyl]methyl]-1,2,4-oxadiazol-5-yl]-2-diethoxyphosphorylpropanoate |
|---|---|
| PubChem CID | 156800113 |
| Molecular Formula | C26H32ClN2O6P |
| Molecular Weight | 534.98 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | tert-butyl 3-[3-[[4-(4-chlorophenyl)phenyl]methyl]-1,2,4-oxadiazol-5-yl]-2-diethoxyphosphorylpropanoate |
| SMILES | CCOP(=O)(OCC)C(Cc1nc(Cc2ccc(-c3ccc(Cl)cc3)cc2)no1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H32ClN2O6P/c1-6-32-36(31,33-7-2)22(25(30)34-26(3,4)5)17-24-28-23(29-35-24)16-18-8-10-19(11-9-18)20-12-14-21(27)15-13-20/h8-15,22H,6-7,16-17H2,1-5H3 |
| InChIKey | TWQIHABXGGTPEI-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 100.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.98 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|