C28H37F2N5 — CID 156800213
ethane;1-ethanimidoyl-5,6-difluoro-4-(5-methyl-3,4-dihydro-2H-quinolin-1-yl)quinazolin-2-imine;1-ethyl-1-methylcyclopropane (PubChem CID 156800213) has the molecular formula C28H37F2N5 and a molecular weight of 481.64 g/mol. Its IUPAC name is ethane;1-ethanimidoyl-5,6-difluoro-4-(5-methyl-3,4-dihydro-2H-quinolin-1-yl)quinazolin-2-imine;1-ethyl-1-methylcyclopropane.
| Compound Name | ethane;1-ethanimidoyl-5,6-difluoro-4-(5-methyl-3,4-dihydro-2H-quinolin-1-yl)quinazolin-2-imine;1-ethyl-1-methylcyclopropane |
|---|---|
| PubChem CID | 156800213 |
| Molecular Formula | C28H37F2N5 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.30 |
| IUPAC Name | ethane;1-ethanimidoyl-5,6-difluoro-4-(5-methyl-3,4-dihydro-2H-quinolin-1-yl)quinazolin-2-imine;1-ethyl-1-methylcyclopropane |
| SMILES | CC.CCC1(C)CC1.[H]/N=C(\C)n1/c(=N/[H])nc(N2CCCc3c(C)cccc32)c2c(F)c(F)ccc21 |
| InChI | InChI=1S/C20H19F2N5.C6H12.C2H6/c1-11-5-3-7-15-13(11)6-4-10-26(15)19-17-16(9-8-14(21)18(17)22)27(12(2)23)20(24)25-19;1-3-6(2)4-5-6;1-2/h3,5,7-9,23-24H,4,6,10H2,1-2H3;3-5H2,1-2H3;1-2H3/b23-12+,24-20+;; |
| InChIKey | PFSWCAPDZASBBU-RUFSHJHKSA-N |
| XLogP | 7.25 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|