C18H21F2N — CID 156800240
6-[2-[1-(1,1-difluoroethyl)cyclopropyl]ethynyl]-1-methyl-2,3,4,5-tetrahydro-1-benzazepine (PubChem CID 156800240) has the molecular formula C18H21F2N and a molecular weight of 289.37 g/mol. Its IUPAC name is 6-[2-[1-(1,1-difluoroethyl)cyclopropyl]ethynyl]-1-methyl-2,3,4,5-tetrahydro-1-benzazepine.
| Compound Name | 6-[2-[1-(1,1-difluoroethyl)cyclopropyl]ethynyl]-1-methyl-2,3,4,5-tetrahydro-1-benzazepine |
|---|---|
| PubChem CID | 156800240 |
| Molecular Formula | C18H21F2N |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 6-[2-[1-(1,1-difluoroethyl)cyclopropyl]ethynyl]-1-methyl-2,3,4,5-tetrahydro-1-benzazepine |
| SMILES | CN1CCCCc2c(C#CC3(C(C)(F)F)CC3)cccc21 |
| InChI | InChI=1S/C18H21F2N/c1-17(19,20)18(11-12-18)10-9-14-6-5-8-16-15(14)7-3-4-13-21(16)2/h5-6,8H,3-4,7,11-13H2,1-2H3 |
| InChIKey | XOTOTWHXCXNBHV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|