About 2-(1-bromoethenyl)-4-methyl-3-[(Z)-prop-1-enyl]-6,7-dihydro-5H-1,4-oxazepine
2-(1-bromoethenyl)-4-methyl-3-[(Z)-prop-1-enyl]-6,7-dihydro-5H-1,4-oxazepine (PubChem CID 156800278) has the molecular formula C11H16BrNO
and a molecular weight of 258.16 g/mol. Its IUPAC name is 2-(1-bromoethenyl)-4-methyl-3-[(Z)-prop-1-enyl]-6,7-dihydro-5H-1,4-oxazepine.
Molecular Properties
| Compound Name | 2-(1-bromoethenyl)-4-methyl-3-[(Z)-prop-1-enyl]-6,7-dihydro-5H-1,4-oxazepine |
| PubChem CID | 156800278 |
| Molecular Formula | C11H16BrNO |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 2-(1-bromoethenyl)-4-methyl-3-[(Z)-prop-1-enyl]-6,7-dihydro-5H-1,4-oxazepine |
| SMILES | C=C(Br)C1=C(/C=C\C)N(C)CCCO1 |
| InChI | InChI=1S/C11H16BrNO/c1-4-6-10-11(9(2)12)14-8-5-7-13(10)3/h4,6H,2,5,7-8H2,1,3H3/b6-4- |
| InChIKey | NTZXWOAXGTUCAJ-XQRVVYSFSA-N |
| XLogP | 3.03 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1-bromoethenyl)-4-methyl-3-[(Z)-prop-1-enyl]-6,7-dihydro-5H-1,4-oxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-bromoethenyl)-4-methyl-3-[(Z)-prop-1-enyl]-6,7-dihydro-5H-1,4-oxazepine?
The IUPAC name of 2-(1-bromoethenyl)-4-methyl-3-[(Z)-prop-1-enyl]-6,7-dihydro-5H-1,4-oxazepine (CID 156800278) is 2-(1-bromoethenyl)-4-methyl-3-[(Z)-prop-1-enyl]-6,7-dihydro-5H-1,4-oxazepine.
What is the SMILES notation for 2-(1-bromoethenyl)-4-methyl-3-[(Z)-prop-1-enyl]-6,7-dihydro-5H-1,4-oxazepine?
The canonical SMILES for 2-(1-bromoethenyl)-4-methyl-3-[(Z)-prop-1-enyl]-6,7-dihydro-5H-1,4-oxazepine is C=C(Br)C1=C(/C=C\C)N(C)CCCO1.
What is the InChIKey of 2-(1-bromoethenyl)-4-methyl-3-[(Z)-prop-1-enyl]-6,7-dihydro-5H-1,4-oxazepine?
The InChIKey is NTZXWOAXGTUCAJ-XQRVVYSFSA-N. The full InChI is InChI=1S/C11H16BrNO/c1-4-6-10-11(9(2)12)14-8-5-7-13(10)3/h4,6H,2,5,7-8H2,1,3H3/b6-4-.
What are the key properties of 2-(1-bromoethenyl)-4-methyl-3-[(Z)-prop-1-enyl]-6,7-dihydro-5H-1,4-oxazepine?
2-(1-bromoethenyl)-4-methyl-3-[(Z)-prop-1-enyl]-6,7-dihydro-5H-1,4-oxazepine has a molecular weight of 258.16 g/mol, XLogP of 3.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-bromoethenyl)-4-methyl-3-[(Z)-prop-1-enyl]-6,7-dihydro-5H-1,4-oxazepine is sourced from PubChem (CID 156800278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).