About ethane;1-methyl-5-[2-(1-methylcyclopropyl)ethynyl]-3,4-dihydro-2H-1,8-naphthyridine
ethane;1-methyl-5-[2-(1-methylcyclopropyl)ethynyl]-3,4-dihydro-2H-1,8-naphthyridine (PubChem CID 156800352) has the molecular formula C17H24N2
and a molecular weight of 256.39 g/mol. Its IUPAC name is ethane;1-methyl-5-[2-(1-methylcyclopropyl)ethynyl]-3,4-dihydro-2H-1,8-naphthyridine.
Molecular Properties
| Compound Name | ethane;1-methyl-5-[2-(1-methylcyclopropyl)ethynyl]-3,4-dihydro-2H-1,8-naphthyridine |
| PubChem CID | 156800352 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | ethane;1-methyl-5-[2-(1-methylcyclopropyl)ethynyl]-3,4-dihydro-2H-1,8-naphthyridine |
| SMILES | CC.CN1CCCc2c(C#CC3(C)CC3)ccnc21 |
| InChI | InChI=1S/C15H18N2.C2H6/c1-15(8-9-15)7-5-12-6-10-16-14-13(12)4-3-11-17(14)2;1-2/h6,10H,3-4,8-9,11H2,1-2H3;1-2H3 |
| InChIKey | GTTNIPOWBJCNSF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-methyl-5-[2-(1-methylcyclopropyl)ethynyl]-3,4-dihydro-2H-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-5-[2-(1-methylcyclopropyl)ethynyl]-3,4-dihydro-2H-1,8-naphthyridine?
The IUPAC name of ethane;1-methyl-5-[2-(1-methylcyclopropyl)ethynyl]-3,4-dihydro-2H-1,8-naphthyridine (CID 156800352) is ethane;1-methyl-5-[2-(1-methylcyclopropyl)ethynyl]-3,4-dihydro-2H-1,8-naphthyridine.
What is the SMILES notation for ethane;1-methyl-5-[2-(1-methylcyclopropyl)ethynyl]-3,4-dihydro-2H-1,8-naphthyridine?
The canonical SMILES for ethane;1-methyl-5-[2-(1-methylcyclopropyl)ethynyl]-3,4-dihydro-2H-1,8-naphthyridine is CC.CN1CCCc2c(C#CC3(C)CC3)ccnc21.
What is the InChIKey of ethane;1-methyl-5-[2-(1-methylcyclopropyl)ethynyl]-3,4-dihydro-2H-1,8-naphthyridine?
The InChIKey is GTTNIPOWBJCNSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2.C2H6/c1-15(8-9-15)7-5-12-6-10-16-14-13(12)4-3-11-17(14)2;1-2/h6,10H,3-4,8-9,11H2,1-2H3;1-2H3.
What are the key properties of ethane;1-methyl-5-[2-(1-methylcyclopropyl)ethynyl]-3,4-dihydro-2H-1,8-naphthyridine?
ethane;1-methyl-5-[2-(1-methylcyclopropyl)ethynyl]-3,4-dihydro-2H-1,8-naphthyridine has a molecular weight of 256.39 g/mol, XLogP of 3.64, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-5-[2-(1-methylcyclopropyl)ethynyl]-3,4-dihydro-2H-1,8-naphthyridine is sourced from PubChem (CID 156800352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).