About (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 1-methyl-4H-pyridine-3-carboxylate
(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 1-methyl-4H-pyridine-3-carboxylate (PubChem CID 15680056) has the molecular formula C12H12FN3O4
and a molecular weight of 281.24 g/mol. Its IUPAC name is (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 1-methyl-4H-pyridine-3-carboxylate.
Molecular Properties
| Compound Name | (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 1-methyl-4H-pyridine-3-carboxylate |
| PubChem CID | 15680056 |
| Molecular Formula | C12H12FN3O4 |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 1-methyl-4H-pyridine-3-carboxylate |
| SMILES | CN1C=CCC(C(=O)OCn2cc(F)c(=O)[nH]c2=O)=C1 |
| InChI | InChI=1S/C12H12FN3O4/c1-15-4-2-3-8(5-15)11(18)20-7-16-6-9(13)10(17)14-12(16)19/h2,4-6H,3,7H2,1H3,(H,14,17,19) |
| InChIKey | KWTRXUIRMOLIFF-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 1-methyl-4H-pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 1-methyl-4H-pyridine-3-carboxylate?
The IUPAC name of (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 1-methyl-4H-pyridine-3-carboxylate (CID 15680056) is (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 1-methyl-4H-pyridine-3-carboxylate.
What is the SMILES notation for (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 1-methyl-4H-pyridine-3-carboxylate?
The canonical SMILES for (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 1-methyl-4H-pyridine-3-carboxylate is CN1C=CCC(C(=O)OCn2cc(F)c(=O)[nH]c2=O)=C1.
What is the InChIKey of (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 1-methyl-4H-pyridine-3-carboxylate?
The InChIKey is KWTRXUIRMOLIFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12FN3O4/c1-15-4-2-3-8(5-15)11(18)20-7-16-6-9(13)10(17)14-12(16)19/h2,4-6H,3,7H2,1H3,(H,14,17,19).
What are the key properties of (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 1-methyl-4H-pyridine-3-carboxylate?
(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 1-methyl-4H-pyridine-3-carboxylate has a molecular weight of 281.24 g/mol, XLogP of -0.09, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl 1-methyl-4H-pyridine-3-carboxylate is sourced from PubChem (CID 15680056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).