C14H21N5O4Si — CID 156800678
2-hydrazinyl-7-nitro-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one (PubChem CID 156800678) has the molecular formula C14H21N5O4Si and a molecular weight of 351.44 g/mol. Its IUPAC name is 2-hydrazinyl-7-nitro-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one.
| Compound Name | 2-hydrazinyl-7-nitro-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 156800678 |
| Molecular Formula | C14H21N5O4Si |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 2-hydrazinyl-7-nitro-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one |
| SMILES | C[Si](C)(C)CCOCn1c(NN)nc2cc([N+](=O)[O-])ccc2c1=O |
| InChI | InChI=1S/C14H21N5O4Si/c1-24(2,3)7-6-23-9-18-13(20)11-5-4-10(19(21)22)8-12(11)16-14(18)17-15/h4-5,8H,6-7,9,15H2,1-3H3,(H,16,17) |
| InChIKey | MGGJSZDUFFQPTB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 125.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|