C18H16N6 — CID 156800848
8-(2-aminoethynyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-[1,2,4]triazolo[4,3-a]quinazolin-5-amine (PubChem CID 156800848) has the molecular formula C18H16N6 and a molecular weight of 316.37 g/mol. Its IUPAC name is 8-(2-aminoethynyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-[1,2,4]triazolo[4,3-a]quinazolin-5-amine.
| Compound Name | 8-(2-aminoethynyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-[1,2,4]triazolo[4,3-a]quinazolin-5-amine |
|---|---|
| PubChem CID | 156800848 |
| Molecular Formula | C18H16N6 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 8-(2-aminoethynyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-[1,2,4]triazolo[4,3-a]quinazolin-5-amine |
| SMILES | C=C/C=C(\C=C)N(C)c1nc2nncn2c2cc(C#CN)ccc12 |
| InChI | InChI=1S/C18H16N6/c1-4-6-14(5-2)23(3)17-15-8-7-13(9-10-19)11-16(15)24-12-20-22-18(24)21-17/h4-8,11-12H,1-2,19H2,3H3/b14-6+ |
| InChIKey | MBTGXPRXUNYFEQ-MKMNVTDBSA-N |
| XLogP | 2.24 |
| TPSA | 72.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|