About CID 156801565
CID 156801565 (PubChem CID 156801565) has the molecular formula C9H23N2O2Si
and a molecular weight of 219.38 g/mol.
Molecular Properties
| Compound Name | CID 156801565 |
| PubChem CID | 156801565 |
| Molecular Formula | C9H23N2O2Si |
| Molecular Weight | 219.38 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | — |
| SMILES | COCCO[Si](C)CCNCC(C)N |
| InChI | InChI=1S/C9H23N2O2Si/c1-9(10)8-11-4-7-14(3)13-6-5-12-2/h9,11H,4-8,10H2,1-3H3 |
| InChIKey | NANGCJMVFGAJTH-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.38 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 156801565 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156801565?
The IUPAC name of CID 156801565 (CID 156801565) is not available.
What is the SMILES notation for CID 156801565?
The canonical SMILES for CID 156801565 is COCCO[Si](C)CCNCC(C)N.
What is the InChIKey of CID 156801565?
The InChIKey is NANGCJMVFGAJTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H23N2O2Si/c1-9(10)8-11-4-7-14(3)13-6-5-12-2/h9,11H,4-8,10H2,1-3H3.
What are the key properties of CID 156801565?
CID 156801565 has a molecular weight of 219.38 g/mol, XLogP of 0.21, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156801565 is sourced from PubChem (CID 156801565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).