About N-methyl-1-[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine
N-methyl-1-[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine (PubChem CID 156801741) has the molecular formula C8H14N4O
and a molecular weight of 182.23 g/mol. Its IUPAC name is N-methyl-1-[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine.
Molecular Properties
| Compound Name | N-methyl-1-[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine |
| PubChem CID | 156801741 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | N-methyl-1-[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine |
| SMILES | CNCC1(Cn2cncn2)COC1 |
| InChI | InChI=1S/C8H14N4O/c1-9-2-8(4-13-5-8)3-12-7-10-6-11-12/h6-7,9H,2-5H2,1H3 |
| InChIKey | VSTGZKJUTLREJL-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-1-[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine?
The IUPAC name of N-methyl-1-[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine (CID 156801741) is N-methyl-1-[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine.
What is the SMILES notation for N-methyl-1-[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine?
The canonical SMILES for N-methyl-1-[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine is CNCC1(Cn2cncn2)COC1.
What is the InChIKey of N-methyl-1-[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine?
The InChIKey is VSTGZKJUTLREJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4O/c1-9-2-8(4-13-5-8)3-12-7-10-6-11-12/h6-7,9H,2-5H2,1H3.
What are the key properties of N-methyl-1-[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine?
N-methyl-1-[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine has a molecular weight of 182.23 g/mol, XLogP of -0.49, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine is sourced from PubChem (CID 156801741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).