About [3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine
[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine (PubChem CID 156801763) has the molecular formula C7H12N4O
and a molecular weight of 168.20 g/mol. Its IUPAC name is [3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine.
Molecular Properties
| Compound Name | [3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine |
| PubChem CID | 156801763 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | [3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine |
| SMILES | NCC1(Cn2cncn2)COC1 |
| InChI | InChI=1S/C7H12N4O/c8-1-7(3-12-4-7)2-11-6-9-5-10-11/h5-6H,1-4,8H2 |
| InChIKey | XCLZQNXTTARXOP-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine?
The IUPAC name of [3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine (CID 156801763) is [3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine.
What is the SMILES notation for [3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine?
The canonical SMILES for [3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine is NCC1(Cn2cncn2)COC1.
What is the InChIKey of [3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine?
The InChIKey is XCLZQNXTTARXOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O/c8-1-7(3-12-4-7)2-11-6-9-5-10-11/h5-6H,1-4,8H2.
What are the key properties of [3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine?
[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine has a molecular weight of 168.20 g/mol, XLogP of -0.75, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine is sourced from PubChem (CID 156801763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).