About CID 156802196
CID 156802196 (PubChem CID 156802196) has the molecular formula C27H36FN8O2S-
and a molecular weight of 555.70 g/mol.
Molecular Properties
| Compound Name | CID 156802196 |
| PubChem CID | 156802196 |
| Molecular Formula | C27H36FN8O2S- |
| Molecular Weight | 555.70 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | — |
| SMILES | [H]/N=[S-](=O)/[C@@H](CC)C1CN(c2ncc(C(C)C)c3cc(Nc4ccnc(N5CC[C@@H](OC)[C@@H](F)C5)n4)ncc23)C1 |
| InChI | InChI=1S/C27H36FN8O2S/c1-5-23(39(29)37)17-13-36(14-17)26-20-12-31-25(10-18(20)19(11-32-26)16(2)3)33-24-6-8-30-27(34-24)35-9-7-22(38-4)21(28)15-35/h6,8,10-12,16-17,21-23,29H,5,7,9,13-15H2,1-4H3,(H,30,31,33,34)/q-1/t21-,22+,23-/m0/s1 |
| InChIKey | FRIVIDJBLVPJLG-ZRBLBEILSA-N |
| XLogP | 4.79 |
| TPSA | 120.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 555.70 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze CID 156802196 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156802196?
The IUPAC name of CID 156802196 (CID 156802196) is not available.
What is the SMILES notation for CID 156802196?
The canonical SMILES for CID 156802196 is [H]/N=[S-](=O)/[C@@H](CC)C1CN(c2ncc(C(C)C)c3cc(Nc4ccnc(N5CC[C@@H](OC)[C@@H](F)C5)n4)ncc23)C1.
What is the InChIKey of CID 156802196?
The InChIKey is FRIVIDJBLVPJLG-ZRBLBEILSA-N. The full InChI is InChI=1S/C27H36FN8O2S/c1-5-23(39(29)37)17-13-36(14-17)26-20-12-31-25(10-18(20)19(11-32-26)16(2)3)33-24-6-8-30-27(34-24)35-9-7-22(38-4)21(28)15-35/h6,8,10-12,16-17,21-23,29H,5,7,9,13-15H2,1-4H3,(H,30,31,33,34)/q-1/t21-,22+,23-/m0/s1.
What are the key properties of CID 156802196?
CID 156802196 has a molecular weight of 555.70 g/mol, XLogP of 4.79, 9 rotatable bonds, 2 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156802196 is sourced from PubChem (CID 156802196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).