C27H36FN8O2S- — CID 156802196
CID 156802196 (PubChem CID 156802196) has the molecular formula C27H36FN8O2S- and a molecular weight of 555.70 g/mol.
| Compound Name | CID 156802196 |
|---|---|
| PubChem CID | 156802196 |
| Molecular Formula | C27H36FN8O2S- |
| Molecular Weight | 555.70 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | — |
| SMILES | [H]/N=[S-](=O)/[C@@H](CC)C1CN(c2ncc(C(C)C)c3cc(Nc4ccnc(N5CC[C@@H](OC)[C@@H](F)C5)n4)ncc23)C1 |
| InChI | InChI=1S/C27H36FN8O2S/c1-5-23(39(29)37)17-13-36(14-17)26-20-12-31-25(10-18(20)19(11-32-26)16(2)3)33-24-6-8-30-27(34-24)35-9-7-22(38-4)21(28)15-35/h6,8,10-12,16-17,21-23,29H,5,7,9,13-15H2,1-4H3,(H,30,31,33,34)/q-1/t21-,22+,23-/m0/s1 |
| InChIKey | FRIVIDJBLVPJLG-ZRBLBEILSA-N |
| XLogP | 4.79 |
| TPSA | 120.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.70 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|