C28H38B2N6O2S — CID 156802307
CID 156802307 (PubChem CID 156802307) has the molecular formula C28H38B2N6O2S and a molecular weight of 544.34 g/mol.
| Compound Name | CID 156802307 |
|---|---|
| PubChem CID | 156802307 |
| Molecular Formula | C28H38B2N6O2S |
| Molecular Weight | 544.34 g/mol |
| Exact Mass | 544.30 |
| IUPAC Name | — |
| SMILES | CSC.[B]C([B])(O)OC1CCN(c2nccc(Nc3cc4c(C(C)C)ccc(N5CCC5C)c4cn3)n2)CC1 |
| InChI | InChI=1S/C26H32B2N6O2.C2H6S/c1-16(2)19-4-5-22(34-13-7-17(34)3)21-15-30-24(14-20(19)21)31-23-6-10-29-25(32-23)33-11-8-18(9-12-33)36-26(27,28)35;1-3-2/h4-6,10,14-18,35H,7-9,11-13H2,1-3H3,(H,29,30,31,32);1-2H3 |
| InChIKey | VHJPFCAGVGGROM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.34 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|