C26H54FN3 — CID 156802548
(E)-9-N-(9-amino-2-fluoro-3-methylnonyl)-7,10-dimethyl-1-N-propan-2-ylundec-8-ene-1,9-diamine (PubChem CID 156802548) has the molecular formula C26H54FN3 and a molecular weight of 427.74 g/mol. Its IUPAC name is (E)-9-N-(9-amino-2-fluoro-3-methylnonyl)-7,10-dimethyl-1-N-propan-2-ylundec-8-ene-1,9-diamine.
| Compound Name | (E)-9-N-(9-amino-2-fluoro-3-methylnonyl)-7,10-dimethyl-1-N-propan-2-ylundec-8-ene-1,9-diamine |
|---|---|
| PubChem CID | 156802548 |
| Molecular Formula | C26H54FN3 |
| Molecular Weight | 427.74 g/mol |
| Exact Mass | 427.43 |
| IUPAC Name | (E)-9-N-(9-amino-2-fluoro-3-methylnonyl)-7,10-dimethyl-1-N-propan-2-ylundec-8-ene-1,9-diamine |
| SMILES | CC(/C=C(/NCC(F)C(C)CCCCCCN)C(C)C)CCCCCCNC(C)C |
| InChI | InChI=1S/C26H54FN3/c1-21(2)26(19-23(5)15-11-8-10-14-18-29-22(3)4)30-20-25(27)24(6)16-12-7-9-13-17-28/h19,21-25,29-30H,7-18,20,28H2,1-6H3/b26-19+ |
| InChIKey | QTXHDIOTQJGLGJ-LGUFXXKBSA-N |
| XLogP | 6.58 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.74 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|