About 4-butylmorpholine;ethane;N-ethyl-N-methylformamide
4-butylmorpholine;ethane;N-ethyl-N-methylformamide (PubChem CID 156802754) has the molecular formula C14H32N2O2
and a molecular weight of 260.42 g/mol. Its IUPAC name is 4-butylmorpholine;ethane;N-ethyl-N-methylformamide.
Molecular Properties
| Compound Name | 4-butylmorpholine;ethane;N-ethyl-N-methylformamide |
| PubChem CID | 156802754 |
| Molecular Formula | C14H32N2O2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.25 |
| IUPAC Name | 4-butylmorpholine;ethane;N-ethyl-N-methylformamide |
| SMILES | CC.CCCCN1CCOCC1.CCN(C)C=O |
| InChI | InChI=1S/C8H17NO.C4H9NO.C2H6/c1-2-3-4-9-5-7-10-8-6-9;1-3-5(2)4-6;1-2/h2-8H2,1H3;4H,3H2,1-2H3;1-2H3 |
| InChIKey | DUHSFUSTGNXAGZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-butylmorpholine;ethane;N-ethyl-N-methylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butylmorpholine;ethane;N-ethyl-N-methylformamide?
The IUPAC name of 4-butylmorpholine;ethane;N-ethyl-N-methylformamide (CID 156802754) is 4-butylmorpholine;ethane;N-ethyl-N-methylformamide.
What is the SMILES notation for 4-butylmorpholine;ethane;N-ethyl-N-methylformamide?
The canonical SMILES for 4-butylmorpholine;ethane;N-ethyl-N-methylformamide is CC.CCCCN1CCOCC1.CCN(C)C=O.
What is the InChIKey of 4-butylmorpholine;ethane;N-ethyl-N-methylformamide?
The InChIKey is DUHSFUSTGNXAGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO.C4H9NO.C2H6/c1-2-3-4-9-5-7-10-8-6-9;1-3-5(2)4-6;1-2/h2-8H2,1H3;4H,3H2,1-2H3;1-2H3.
What are the key properties of 4-butylmorpholine;ethane;N-ethyl-N-methylformamide?
4-butylmorpholine;ethane;N-ethyl-N-methylformamide has a molecular weight of 260.42 g/mol, XLogP of 2.24, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butylmorpholine;ethane;N-ethyl-N-methylformamide is sourced from PubChem (CID 156802754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).