About 2-(azetidin-1-yl)cyclohexan-1-one;benzene
2-(azetidin-1-yl)cyclohexan-1-one;benzene (PubChem CID 156803276) has the molecular formula C15H21NO
and a molecular weight of 231.34 g/mol. Its IUPAC name is 2-(azetidin-1-yl)cyclohexan-1-one;benzene.
Molecular Properties
| Compound Name | 2-(azetidin-1-yl)cyclohexan-1-one;benzene |
| PubChem CID | 156803276 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 2-(azetidin-1-yl)cyclohexan-1-one;benzene |
| SMILES | O=C1CCCCC1N1CCC1.c1ccccc1 |
| InChI | InChI=1S/C9H15NO.C6H6/c11-9-5-2-1-4-8(9)10-6-3-7-10;1-2-4-6-5-3-1/h8H,1-7H2;1-6H |
| InChIKey | JLQBUJKPIGRFRM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(azetidin-1-yl)cyclohexan-1-one;benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azetidin-1-yl)cyclohexan-1-one;benzene?
The IUPAC name of 2-(azetidin-1-yl)cyclohexan-1-one;benzene (CID 156803276) is 2-(azetidin-1-yl)cyclohexan-1-one;benzene.
What is the SMILES notation for 2-(azetidin-1-yl)cyclohexan-1-one;benzene?
The canonical SMILES for 2-(azetidin-1-yl)cyclohexan-1-one;benzene is O=C1CCCCC1N1CCC1.c1ccccc1.
What is the InChIKey of 2-(azetidin-1-yl)cyclohexan-1-one;benzene?
The InChIKey is JLQBUJKPIGRFRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO.C6H6/c11-9-5-2-1-4-8(9)10-6-3-7-10;1-2-4-6-5-3-1/h8H,1-7H2;1-6H.
What are the key properties of 2-(azetidin-1-yl)cyclohexan-1-one;benzene?
2-(azetidin-1-yl)cyclohexan-1-one;benzene has a molecular weight of 231.34 g/mol, XLogP of 2.89, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azetidin-1-yl)cyclohexan-1-one;benzene is sourced from PubChem (CID 156803276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).