About cyclohexa-1,3-diene;2-(dimethylamino)cyclohexan-1-one
cyclohexa-1,3-diene;2-(dimethylamino)cyclohexan-1-one (PubChem CID 156803298) has the molecular formula C14H23NO
and a molecular weight of 221.34 g/mol. Its IUPAC name is cyclohexa-1,3-diene;2-(dimethylamino)cyclohexan-1-one.
Molecular Properties
| Compound Name | cyclohexa-1,3-diene;2-(dimethylamino)cyclohexan-1-one |
| PubChem CID | 156803298 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | cyclohexa-1,3-diene;2-(dimethylamino)cyclohexan-1-one |
| SMILES | C1=CCCC=C1.CN(C)C1CCCCC1=O |
| InChI | InChI=1S/C8H15NO.C6H8/c1-9(2)7-5-3-4-6-8(7)10;1-2-4-6-5-3-1/h7H,3-6H2,1-2H3;1-4H,5-6H2 |
| InChIKey | XEDCPOOYRLMLLQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexa-1,3-diene;2-(dimethylamino)cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-1,3-diene;2-(dimethylamino)cyclohexan-1-one?
The IUPAC name of cyclohexa-1,3-diene;2-(dimethylamino)cyclohexan-1-one (CID 156803298) is cyclohexa-1,3-diene;2-(dimethylamino)cyclohexan-1-one.
What is the SMILES notation for cyclohexa-1,3-diene;2-(dimethylamino)cyclohexan-1-one?
The canonical SMILES for cyclohexa-1,3-diene;2-(dimethylamino)cyclohexan-1-one is C1=CCCC=C1.CN(C)C1CCCCC1=O.
What is the InChIKey of cyclohexa-1,3-diene;2-(dimethylamino)cyclohexan-1-one?
The InChIKey is XEDCPOOYRLMLLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO.C6H8/c1-9(2)7-5-3-4-6-8(7)10;1-2-4-6-5-3-1/h7H,3-6H2,1-2H3;1-4H,5-6H2.
What are the key properties of cyclohexa-1,3-diene;2-(dimethylamino)cyclohexan-1-one?
cyclohexa-1,3-diene;2-(dimethylamino)cyclohexan-1-one has a molecular weight of 221.34 g/mol, XLogP of 2.95, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-1,3-diene;2-(dimethylamino)cyclohexan-1-one is sourced from PubChem (CID 156803298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).