About 2-fluorocyclohexa-1,3-diene;2-(methylamino)cyclohexan-1-one
2-fluorocyclohexa-1,3-diene;2-(methylamino)cyclohexan-1-one (PubChem CID 156803415) has the molecular formula C13H20FNO
and a molecular weight of 225.31 g/mol. Its IUPAC name is 2-fluorocyclohexa-1,3-diene;2-(methylamino)cyclohexan-1-one.
Molecular Properties
| Compound Name | 2-fluorocyclohexa-1,3-diene;2-(methylamino)cyclohexan-1-one |
| PubChem CID | 156803415 |
| Molecular Formula | C13H20FNO |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 2-fluorocyclohexa-1,3-diene;2-(methylamino)cyclohexan-1-one |
| SMILES | CNC1CCCCC1=O.FC1=CCCC=C1 |
| InChI | InChI=1S/C7H13NO.C6H7F/c1-8-6-4-2-3-5-7(6)9;7-6-4-2-1-3-5-6/h6,8H,2-5H2,1H3;2,4-5H,1,3H2 |
| InChIKey | HWVLQILXNIETDL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-fluorocyclohexa-1,3-diene;2-(methylamino)cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluorocyclohexa-1,3-diene;2-(methylamino)cyclohexan-1-one?
The IUPAC name of 2-fluorocyclohexa-1,3-diene;2-(methylamino)cyclohexan-1-one (CID 156803415) is 2-fluorocyclohexa-1,3-diene;2-(methylamino)cyclohexan-1-one.
What is the SMILES notation for 2-fluorocyclohexa-1,3-diene;2-(methylamino)cyclohexan-1-one?
The canonical SMILES for 2-fluorocyclohexa-1,3-diene;2-(methylamino)cyclohexan-1-one is CNC1CCCCC1=O.FC1=CCCC=C1.
What is the InChIKey of 2-fluorocyclohexa-1,3-diene;2-(methylamino)cyclohexan-1-one?
The InChIKey is HWVLQILXNIETDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.C6H7F/c1-8-6-4-2-3-5-7(6)9;7-6-4-2-1-3-5-6/h6,8H,2-5H2,1H3;2,4-5H,1,3H2.
What are the key properties of 2-fluorocyclohexa-1,3-diene;2-(methylamino)cyclohexan-1-one?
2-fluorocyclohexa-1,3-diene;2-(methylamino)cyclohexan-1-one has a molecular weight of 225.31 g/mol, XLogP of 2.91, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluorocyclohexa-1,3-diene;2-(methylamino)cyclohexan-1-one is sourced from PubChem (CID 156803415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).