About methyl (3S,4R)-3-hydroxy-2,2-dimethyl-4-phenylsulfanylhexanoate
methyl (3S,4R)-3-hydroxy-2,2-dimethyl-4-phenylsulfanylhexanoate (PubChem CID 15680344) has the molecular formula C15H22O3S
and a molecular weight of 282.40 g/mol. Its IUPAC name is methyl (3S,4R)-3-hydroxy-2,2-dimethyl-4-phenylsulfanylhexanoate.
Molecular Properties
| Compound Name | methyl (3S,4R)-3-hydroxy-2,2-dimethyl-4-phenylsulfanylhexanoate |
| PubChem CID | 15680344 |
| Molecular Formula | C15H22O3S |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | methyl (3S,4R)-3-hydroxy-2,2-dimethyl-4-phenylsulfanylhexanoate |
| SMILES | CC[C@@H](Sc1ccccc1)[C@@H](O)C(C)(C)C(=O)OC |
| InChI | InChI=1S/C15H22O3S/c1-5-12(19-11-9-7-6-8-10-11)13(16)15(2,3)14(17)18-4/h6-10,12-13,16H,5H2,1-4H3/t12-,13-/m1/s1 |
| InChIKey | GDEGVZDIKBVCGA-CHWSQXEVSA-N |
| XLogP | 3.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (3S,4R)-3-hydroxy-2,2-dimethyl-4-phenylsulfanylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S,4R)-3-hydroxy-2,2-dimethyl-4-phenylsulfanylhexanoate?
The IUPAC name of methyl (3S,4R)-3-hydroxy-2,2-dimethyl-4-phenylsulfanylhexanoate (CID 15680344) is methyl (3S,4R)-3-hydroxy-2,2-dimethyl-4-phenylsulfanylhexanoate.
What is the SMILES notation for methyl (3S,4R)-3-hydroxy-2,2-dimethyl-4-phenylsulfanylhexanoate?
The canonical SMILES for methyl (3S,4R)-3-hydroxy-2,2-dimethyl-4-phenylsulfanylhexanoate is CC[C@@H](Sc1ccccc1)[C@@H](O)C(C)(C)C(=O)OC.
What is the InChIKey of methyl (3S,4R)-3-hydroxy-2,2-dimethyl-4-phenylsulfanylhexanoate?
The InChIKey is GDEGVZDIKBVCGA-CHWSQXEVSA-N. The full InChI is InChI=1S/C15H22O3S/c1-5-12(19-11-9-7-6-8-10-11)13(16)15(2,3)14(17)18-4/h6-10,12-13,16H,5H2,1-4H3/t12-,13-/m1/s1.
What are the key properties of methyl (3S,4R)-3-hydroxy-2,2-dimethyl-4-phenylsulfanylhexanoate?
methyl (3S,4R)-3-hydroxy-2,2-dimethyl-4-phenylsulfanylhexanoate has a molecular weight of 282.40 g/mol, XLogP of 3.12, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S,4R)-3-hydroxy-2,2-dimethyl-4-phenylsulfanylhexanoate is sourced from PubChem (CID 15680344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).