About CID 156803728
CID 156803728 (PubChem CID 156803728) has the molecular formula C9H17O2Si
and a molecular weight of 185.32 g/mol.
Molecular Properties
| Compound Name | CID 156803728 |
| PubChem CID | 156803728 |
| Molecular Formula | C9H17O2Si |
| Molecular Weight | 185.32 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | — |
| SMILES | CO[Si](OC)C(C1CC1)C1CC1 |
| InChI | InChI=1S/C9H17O2Si/c1-10-12(11-2)9(7-3-4-7)8-5-6-8/h7-9H,3-6H2,1-2H3 |
| InChIKey | MZQOXUKCVNZVQS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 156803728 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156803728?
The IUPAC name of CID 156803728 (CID 156803728) is not available.
What is the SMILES notation for CID 156803728?
The canonical SMILES for CID 156803728 is CO[Si](OC)C(C1CC1)C1CC1.
What is the InChIKey of CID 156803728?
The InChIKey is MZQOXUKCVNZVQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17O2Si/c1-10-12(11-2)9(7-3-4-7)8-5-6-8/h7-9H,3-6H2,1-2H3.
What are the key properties of CID 156803728?
CID 156803728 has a molecular weight of 185.32 g/mol, XLogP of 1.96, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156803728 is sourced from PubChem (CID 156803728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).