C26H34FN2O6P — CID 156804009
1-[4-[(6,8-ditert-butyl-5-fluoro-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]-3-methoxybutyl]-5-ethynylpyrimidine-2,4-dione (PubChem CID 156804009) has the molecular formula C26H34FN2O6P and a molecular weight of 520.54 g/mol. Its IUPAC name is 1-[4-[(6,8-ditert-butyl-5-fluoro-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]-3-methoxybutyl]-5-ethynylpyrimidine-2,4-dione.
| Compound Name | 1-[4-[(6,8-ditert-butyl-5-fluoro-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]-3-methoxybutyl]-5-ethynylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 156804009 |
| Molecular Formula | C26H34FN2O6P |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | 1-[4-[(6,8-ditert-butyl-5-fluoro-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]-3-methoxybutyl]-5-ethynylpyrimidine-2,4-dione |
| SMILES | C#Cc1cn(CCC(COP2OCc3c(F)c(C(C)(C)C)cc(C(C)(C)C)c3O2)OC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C26H34FN2O6P/c1-9-16-13-29(24(31)28-23(16)30)11-10-17(32-8)14-33-36-34-15-18-21(27)19(25(2,3)4)12-20(22(18)35-36)26(5,6)7/h1,12-13,17H,10-11,14-15H2,2-8H3,(H,28,30,31) |
| InChIKey | GSQKOVVMWFBUBO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|