C13H25NO — CID 156804501
1-(4,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)-3,3-dimethylbutan-1-ol (PubChem CID 156804501) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is 1-(4,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)-3,3-dimethylbutan-1-ol.
| Compound Name | 1-(4,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)-3,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 156804501 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | 1-(4,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)-3,3-dimethylbutan-1-ol |
| SMILES | CC1=C(C)CN(C(O)CC(C)(C)C)CC1 |
| InChI | InChI=1S/C13H25NO/c1-10-6-7-14(9-11(10)2)12(15)8-13(3,4)5/h12,15H,6-9H2,1-5H3 |
| InChIKey | SLTAUMVTNXPYKR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|