About ethene;4-thiomorpholin-4-ylaniline
ethene;4-thiomorpholin-4-ylaniline (PubChem CID 156804699) has the molecular formula C12H18N2S
and a molecular weight of 222.36 g/mol. Its IUPAC name is ethene;4-thiomorpholin-4-ylaniline.
Molecular Properties
| Compound Name | ethene;4-thiomorpholin-4-ylaniline |
| PubChem CID | 156804699 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | ethene;4-thiomorpholin-4-ylaniline |
| SMILES | C=C.Nc1ccc(N2CCSCC2)cc1 |
| InChI | InChI=1S/C10H14N2S.C2H4/c11-9-1-3-10(4-2-9)12-5-7-13-8-6-12;1-2/h1-4H,5-8,11H2;1-2H2 |
| InChIKey | XVPZRBDGCATOGM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;4-thiomorpholin-4-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;4-thiomorpholin-4-ylaniline?
The IUPAC name of ethene;4-thiomorpholin-4-ylaniline (CID 156804699) is ethene;4-thiomorpholin-4-ylaniline.
What is the SMILES notation for ethene;4-thiomorpholin-4-ylaniline?
The canonical SMILES for ethene;4-thiomorpholin-4-ylaniline is C=C.Nc1ccc(N2CCSCC2)cc1.
What is the InChIKey of ethene;4-thiomorpholin-4-ylaniline?
The InChIKey is XVPZRBDGCATOGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2S.C2H4/c11-9-1-3-10(4-2-9)12-5-7-13-8-6-12;1-2/h1-4H,5-8,11H2;1-2H2.
What are the key properties of ethene;4-thiomorpholin-4-ylaniline?
ethene;4-thiomorpholin-4-ylaniline has a molecular weight of 222.36 g/mol, XLogP of 2.62, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;4-thiomorpholin-4-ylaniline is sourced from PubChem (CID 156804699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).